C22H24FN5OS — CID 133203178
1-[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]-3-[1-(4-fluorophenyl)ethyl]thiourea (PubChem CID 133203178) has the molecular formula C22H24FN5OS and a molecular weight of 425.53 g/mol. Its IUPAC name is 1-[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]-3-[1-(4-fluorophenyl)ethyl]thiourea.
| Compound Name | 1-[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]-3-[1-(4-fluorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 133203178 |
| Molecular Formula | C22H24FN5OS |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 1-[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]-3-[1-(4-fluorophenyl)ethyl]thiourea |
| SMILES | CCOc1ccc(Nc2cc(C)nc(NC(=S)NC(C)c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C22H24FN5OS/c1-4-29-19-11-9-18(10-12-19)26-20-13-14(2)24-21(27-20)28-22(30)25-15(3)16-5-7-17(23)8-6-16/h5-13,15H,4H2,1-3H3,(H3,24,25,26,27,28,30) |
| InChIKey | ISUDRFYRDADNEN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 71.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|