C23H24FN5O3S — CID 100571301
(3S)-3-[[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]carbamothioylamino]-3-(4-fluorophenyl)propanoic acid (PubChem CID 100571301) has the molecular formula C23H24FN5O3S and a molecular weight of 469.54 g/mol. Its IUPAC name is (3S)-3-[[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]carbamothioylamino]-3-(4-fluorophenyl)propanoic acid.
| Compound Name | (3S)-3-[[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]carbamothioylamino]-3-(4-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 100571301 |
| Molecular Formula | C23H24FN5O3S |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | (3S)-3-[[4-(4-ethoxyanilino)-6-methylpyrimidin-2-yl]carbamothioylamino]-3-(4-fluorophenyl)propanoic acid |
| SMILES | CCOc1ccc(Nc2cc(C)nc(NC(=S)N[C@@H](CC(=O)O)c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C23H24FN5O3S/c1-3-32-18-10-8-17(9-11-18)26-20-12-14(2)25-22(28-20)29-23(33)27-19(13-21(30)31)15-4-6-16(24)7-5-15/h4-12,19H,3,13H2,1-2H3,(H,30,31)(H3,25,26,27,28,29,33)/t19-/m0/s1 |
| InChIKey | GDPXLBXVGWBHIF-IBGZPJMESA-N |
| XLogP | 4.57 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|