C15H14FN3O2S — CID 133203234
3-(4-fluorophenyl)-3-(pyridin-4-ylcarbamothioylamino)propanoic acid (PubChem CID 133203234) has the molecular formula C15H14FN3O2S and a molecular weight of 319.36 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-3-(pyridin-4-ylcarbamothioylamino)propanoic acid.
| Compound Name | 3-(4-fluorophenyl)-3-(pyridin-4-ylcarbamothioylamino)propanoic acid |
|---|---|
| PubChem CID | 133203234 |
| Molecular Formula | C15H14FN3O2S |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 3-(4-fluorophenyl)-3-(pyridin-4-ylcarbamothioylamino)propanoic acid |
| SMILES | O=C(O)CC(NC(=S)Nc1ccncc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H14FN3O2S/c16-11-3-1-10(2-4-11)13(9-14(20)21)19-15(22)18-12-5-7-17-8-6-12/h1-8,13H,9H2,(H,20,21)(H2,17,18,19,22) |
| InChIKey | WGINKCJKYBBLAG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|