C15H15FN2S — CID 92512959
1-[(1R)-1-(4-fluorophenyl)ethyl]-3-phenylthiourea (PubChem CID 92512959) has the molecular formula C15H15FN2S and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-[(1R)-1-(4-fluorophenyl)ethyl]-3-phenylthiourea.
| Compound Name | 1-[(1R)-1-(4-fluorophenyl)ethyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 92512959 |
| Molecular Formula | C15H15FN2S |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-[(1R)-1-(4-fluorophenyl)ethyl]-3-phenylthiourea |
| SMILES | C[C@@H](NC(=S)Nc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H15FN2S/c1-11(12-7-9-13(16)10-8-12)17-15(19)18-14-5-3-2-4-6-14/h2-11H,1H3,(H2,17,18,19)/t11-/m1/s1 |
| InChIKey | FTAPCXPJYLHSGB-LLVKDONJSA-N |
| XLogP | 3.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|