C17H17FN2O2S — CID 100646498
methyl 3-[[(1R)-1-(4-fluorophenyl)ethyl]carbamothioylamino]benzoate (PubChem CID 100646498) has the molecular formula C17H17FN2O2S and a molecular weight of 332.40 g/mol. Its IUPAC name is methyl 3-[[(1R)-1-(4-fluorophenyl)ethyl]carbamothioylamino]benzoate.
| Compound Name | methyl 3-[[(1R)-1-(4-fluorophenyl)ethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100646498 |
| Molecular Formula | C17H17FN2O2S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | methyl 3-[[(1R)-1-(4-fluorophenyl)ethyl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=S)N[C@H](C)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H17FN2O2S/c1-11(12-6-8-14(18)9-7-12)19-17(23)20-15-5-3-4-13(10-15)16(21)22-2/h3-11H,1-2H3,(H2,19,20,23)/t11-/m1/s1 |
| InChIKey | XCMCTRJNDWMWOO-LLVKDONJSA-N |
| XLogP | 3.66 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|