C17H16ClFN2O2S — CID 100646435
methyl 4-chloro-3-[[(1S)-1-(4-fluorophenyl)ethyl]carbamothioylamino]benzoate (PubChem CID 100646435) has the molecular formula C17H16ClFN2O2S and a molecular weight of 366.85 g/mol. Its IUPAC name is methyl 4-chloro-3-[[(1S)-1-(4-fluorophenyl)ethyl]carbamothioylamino]benzoate.
| Compound Name | methyl 4-chloro-3-[[(1S)-1-(4-fluorophenyl)ethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100646435 |
| Molecular Formula | C17H16ClFN2O2S |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | methyl 4-chloro-3-[[(1S)-1-(4-fluorophenyl)ethyl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=S)N[C@@H](C)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H16ClFN2O2S/c1-10(11-3-6-13(19)7-4-11)20-17(24)21-15-9-12(16(22)23-2)5-8-14(15)18/h3-10H,1-2H3,(H2,20,21,24)/t10-/m0/s1 |
| InChIKey | AYTAUHATUCSAQH-JTQLQIEISA-N |
| XLogP | 4.31 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|