C19H21ClN2O4S — CID 100580225
methyl 4-chloro-3-[[(2R)-1-(4-methoxyphenoxy)propan-2-yl]carbamothioylamino]benzoate (PubChem CID 100580225) has the molecular formula C19H21ClN2O4S and a molecular weight of 408.91 g/mol. Its IUPAC name is methyl 4-chloro-3-[[(2R)-1-(4-methoxyphenoxy)propan-2-yl]carbamothioylamino]benzoate.
| Compound Name | methyl 4-chloro-3-[[(2R)-1-(4-methoxyphenoxy)propan-2-yl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100580225 |
| Molecular Formula | C19H21ClN2O4S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | methyl 4-chloro-3-[[(2R)-1-(4-methoxyphenoxy)propan-2-yl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=S)N[C@H](C)COc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C19H21ClN2O4S/c1-12(11-26-15-7-5-14(24-2)6-8-15)21-19(27)22-17-10-13(18(23)25-3)4-9-16(17)20/h4-10,12H,11H2,1-3H3,(H2,21,22,27)/t12-/m1/s1 |
| InChIKey | CEHOYPBEXYOGLE-GFCCVEGCSA-N |
| XLogP | 3.89 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|