C27H30N2O2S — CID 100643661
1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(1R)-1-(4-methoxyphenyl)ethyl]thiourea (PubChem CID 100643661) has the molecular formula C27H30N2O2S and a molecular weight of 446.62 g/mol. Its IUPAC name is 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(1R)-1-(4-methoxyphenyl)ethyl]thiourea.
| Compound Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(1R)-1-(4-methoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 100643661 |
| Molecular Formula | C27H30N2O2S |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(1R)-1-(4-methoxyphenyl)ethyl]thiourea |
| SMILES | COc1ccc([C@@H](C)NC(=S)Nc2cccc(C(=O)c3ccc(C(C)(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C27H30N2O2S/c1-18(19-11-15-24(31-5)16-12-19)28-26(32)29-23-8-6-7-21(17-23)25(30)20-9-13-22(14-10-20)27(2,3)4/h6-18H,1-5H3,(H2,28,29,32)/t18-/m1/s1 |
| InChIKey | GUTMIHMJRWJYIX-GOSISDBHSA-N |
| XLogP | 6.27 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|