C28H32N2O2S — CID 133215535
1-[3-(4-tert-butylbenzoyl)phenyl]-3-[1-(4-methoxyphenyl)propyl]thiourea (PubChem CID 133215535) has the molecular formula C28H32N2O2S and a molecular weight of 460.64 g/mol. Its IUPAC name is 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[1-(4-methoxyphenyl)propyl]thiourea.
| Compound Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[1-(4-methoxyphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 133215535 |
| Molecular Formula | C28H32N2O2S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[1-(4-methoxyphenyl)propyl]thiourea |
| SMILES | CCC(NC(=S)Nc1cccc(C(=O)c2ccc(C(C)(C)C)cc2)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H32N2O2S/c1-6-25(19-12-16-24(32-5)17-13-19)30-27(33)29-23-9-7-8-21(18-23)26(31)20-10-14-22(15-11-20)28(2,3)4/h7-18,25H,6H2,1-5H3,(H2,29,30,33) |
| InChIKey | PGTKHWFNOORZLQ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|