C27H30N2OS — CID 100645106
1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(1R)-1-(4-methylphenyl)ethyl]thiourea (PubChem CID 100645106) has the molecular formula C27H30N2OS and a molecular weight of 430.62 g/mol. Its IUPAC name is 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(1R)-1-(4-methylphenyl)ethyl]thiourea.
| Compound Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(1R)-1-(4-methylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 100645106 |
| Molecular Formula | C27H30N2OS |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(1R)-1-(4-methylphenyl)ethyl]thiourea |
| SMILES | Cc1ccc([C@@H](C)NC(=S)Nc2cccc(C(=O)c3ccc(C(C)(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C27H30N2OS/c1-18-9-11-20(12-10-18)19(2)28-26(31)29-24-8-6-7-22(17-24)25(30)21-13-15-23(16-14-21)27(3,4)5/h6-17,19H,1-5H3,(H2,28,29,31)/t19-/m1/s1 |
| InChIKey | PFCXGNYRWRWHCG-LJQANCHMSA-N |
| XLogP | 6.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|