C26H34N2OS — CID 100770632
1-[3-(4-tert-butylbenzoyl)phenyl]-3-(1-propan-2-ylcyclopentyl)thiourea (PubChem CID 100770632) has the molecular formula C26H34N2OS and a molecular weight of 422.64 g/mol. Its IUPAC name is 1-[3-(4-tert-butylbenzoyl)phenyl]-3-(1-propan-2-ylcyclopentyl)thiourea.
| Compound Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-(1-propan-2-ylcyclopentyl)thiourea |
|---|---|
| PubChem CID | 100770632 |
| Molecular Formula | C26H34N2OS |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-(1-propan-2-ylcyclopentyl)thiourea |
| SMILES | CC(C)C1(NC(=S)Nc2cccc(C(=O)c3ccc(C(C)(C)C)cc3)c2)CCCC1 |
| InChI | InChI=1S/C26H34N2OS/c1-18(2)26(15-6-7-16-26)28-24(30)27-22-10-8-9-20(17-22)23(29)19-11-13-21(14-12-19)25(3,4)5/h8-14,17-18H,6-7,15-16H2,1-5H3,(H2,27,28,30) |
| InChIKey | LZWNIKFXXONQSG-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|