C24H31N3OS — CID 100754936
1-[3-(4-tert-butylbenzoyl)phenyl]-3-(1-methylpiperidin-4-yl)thiourea (PubChem CID 100754936) has the molecular formula C24H31N3OS and a molecular weight of 409.60 g/mol. Its IUPAC name is 1-[3-(4-tert-butylbenzoyl)phenyl]-3-(1-methylpiperidin-4-yl)thiourea.
| Compound Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-(1-methylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 100754936 |
| Molecular Formula | C24H31N3OS |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-(1-methylpiperidin-4-yl)thiourea |
| SMILES | CN1CCC(NC(=S)Nc2cccc(C(=O)c3ccc(C(C)(C)C)cc3)c2)CC1 |
| InChI | InChI=1S/C24H31N3OS/c1-24(2,3)19-10-8-17(9-11-19)22(28)18-6-5-7-21(16-18)26-23(29)25-20-12-14-27(4)15-13-20/h5-11,16,20H,12-15H2,1-4H3,(H2,25,26,29) |
| InChIKey | ZBGFPKOENIWDTE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|