C15H21F2N3O — CID 99823447
1-[3-(1,1-difluoroethyl)phenyl]-3-(1-methylpiperidin-4-yl)urea (PubChem CID 99823447) has the molecular formula C15H21F2N3O and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-[3-(1,1-difluoroethyl)phenyl]-3-(1-methylpiperidin-4-yl)urea.
| Compound Name | 1-[3-(1,1-difluoroethyl)phenyl]-3-(1-methylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 99823447 |
| Molecular Formula | C15H21F2N3O |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-[3-(1,1-difluoroethyl)phenyl]-3-(1-methylpiperidin-4-yl)urea |
| SMILES | CN1CCC(NC(=O)Nc2cccc(C(C)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H21F2N3O/c1-15(16,17)11-4-3-5-13(10-11)19-14(21)18-12-6-8-20(2)9-7-12/h3-5,10,12H,6-9H2,1-2H3,(H2,18,19,21) |
| InChIKey | DRJXFORFTJJMLC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |