C30H35N3O2S — CID 100764227
1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(1S)-1-(4-morpholin-4-ylphenyl)ethyl]thiourea (PubChem CID 100764227) has the molecular formula C30H35N3O2S and a molecular weight of 501.70 g/mol. Its IUPAC name is 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(1S)-1-(4-morpholin-4-ylphenyl)ethyl]thiourea.
| Compound Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(1S)-1-(4-morpholin-4-ylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 100764227 |
| Molecular Formula | C30H35N3O2S |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(1S)-1-(4-morpholin-4-ylphenyl)ethyl]thiourea |
| SMILES | C[C@H](NC(=S)Nc1cccc(C(=O)c2ccc(C(C)(C)C)cc2)c1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C30H35N3O2S/c1-21(22-10-14-27(15-11-22)33-16-18-35-19-17-33)31-29(36)32-26-7-5-6-24(20-26)28(34)23-8-12-25(13-9-23)30(2,3)4/h5-15,20-21H,16-19H2,1-4H3,(H2,31,32,36)/t21-/m0/s1 |
| InChIKey | MTNGVPWILBXFSD-NRFANRHFSA-N |
| XLogP | 6.10 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|