C19H22FN3OS — CID 133231017
1-(3-fluorophenyl)-3-[1-(4-morpholin-4-ylphenyl)ethyl]thiourea (PubChem CID 133231017) has the molecular formula C19H22FN3OS and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[1-(4-morpholin-4-ylphenyl)ethyl]thiourea.
| Compound Name | 1-(3-fluorophenyl)-3-[1-(4-morpholin-4-ylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 133231017 |
| Molecular Formula | C19H22FN3OS |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[1-(4-morpholin-4-ylphenyl)ethyl]thiourea |
| SMILES | CC(NC(=S)Nc1cccc(F)c1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H22FN3OS/c1-14(21-19(25)22-17-4-2-3-16(20)13-17)15-5-7-18(8-6-15)23-9-11-24-12-10-23/h2-8,13-14H,9-12H2,1H3,(H2,21,22,25) |
| InChIKey | RLOXHTGKHPLOOQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|