C19H21F2N3S — CID 100725680
1-(3,4-difluorophenyl)-3-[(1R)-1-(4-pyrrolidin-1-ylphenyl)ethyl]thiourea (PubChem CID 100725680) has the molecular formula C19H21F2N3S and a molecular weight of 361.46 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[(1R)-1-(4-pyrrolidin-1-ylphenyl)ethyl]thiourea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[(1R)-1-(4-pyrrolidin-1-ylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 100725680 |
| Molecular Formula | C19H21F2N3S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[(1R)-1-(4-pyrrolidin-1-ylphenyl)ethyl]thiourea |
| SMILES | C[C@@H](NC(=S)Nc1ccc(F)c(F)c1)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C19H21F2N3S/c1-13(14-4-7-16(8-5-14)24-10-2-3-11-24)22-19(25)23-15-6-9-17(20)18(21)12-15/h4-9,12-13H,2-3,10-11H2,1H3,(H2,22,23,25)/t13-/m1/s1 |
| InChIKey | DZXNLPVIKGPPCL-CYBMUJFWSA-N |
| XLogP | 4.61 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|