C20H23F2N3S — CID 133154990
1-(3,4-difluorophenyl)-3-[1-(4-piperidin-1-ylphenyl)ethyl]thiourea (PubChem CID 133154990) has the molecular formula C20H23F2N3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[1-(4-piperidin-1-ylphenyl)ethyl]thiourea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[1-(4-piperidin-1-ylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 133154990 |
| Molecular Formula | C20H23F2N3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[1-(4-piperidin-1-ylphenyl)ethyl]thiourea |
| SMILES | CC(NC(=S)Nc1ccc(F)c(F)c1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H23F2N3S/c1-14(23-20(26)24-16-7-10-18(21)19(22)13-16)15-5-8-17(9-6-15)25-11-3-2-4-12-25/h5-10,13-14H,2-4,11-12H2,1H3,(H2,23,24,26) |
| InChIKey | QGHHLPAVQUBZQJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|