C32H39N3OS — CID 100712949
1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]thiourea (PubChem CID 100712949) has the molecular formula C32H39N3OS and a molecular weight of 513.75 g/mol. Its IUPAC name is 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]thiourea.
| Compound Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]thiourea |
|---|---|
| PubChem CID | 100712949 |
| Molecular Formula | C32H39N3OS |
| Molecular Weight | 513.75 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]thiourea |
| SMILES | CC1CCN(c2ccc([C@H](C)NC(=S)Nc3cccc(C(=O)c4ccc(C(C)(C)C)cc4)c3)cc2)CC1 |
| InChI | InChI=1S/C32H39N3OS/c1-22-17-19-35(20-18-22)29-15-11-24(12-16-29)23(2)33-31(37)34-28-8-6-7-26(21-28)30(36)25-9-13-27(14-10-25)32(3,4)5/h6-16,21-23H,17-20H2,1-5H3,(H2,33,34,37)/t23-/m0/s1 |
| InChIKey | XXMWOHNTYKGUNK-QHCPKHFHSA-N |
| XLogP | 7.50 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.75 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|