C30H36N2OS — CID 100756802
1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-(4-propan-2-ylphenyl)propyl]thiourea (PubChem CID 100756802) has the molecular formula C30H36N2OS and a molecular weight of 472.70 g/mol. Its IUPAC name is 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-(4-propan-2-ylphenyl)propyl]thiourea.
| Compound Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-(4-propan-2-ylphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 100756802 |
| Molecular Formula | C30H36N2OS |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 1-[3-(4-tert-butylbenzoyl)phenyl]-3-[3-(4-propan-2-ylphenyl)propyl]thiourea |
| SMILES | CC(C)c1ccc(CCCNC(=S)Nc2cccc(C(=O)c3ccc(C(C)(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C30H36N2OS/c1-21(2)23-13-11-22(12-14-23)8-7-19-31-29(34)32-27-10-6-9-25(20-27)28(33)24-15-17-26(18-16-24)30(3,4)5/h6,9-18,20-21H,7-8,19H2,1-5H3,(H2,31,32,34) |
| InChIKey | CHEXPUDRNSXRJJ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|