C20H23F3N2S — CID 100756561
1-[3-(4-propan-2-ylphenyl)propyl]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 100756561) has the molecular formula C20H23F3N2S and a molecular weight of 380.48 g/mol. Its IUPAC name is 1-[3-(4-propan-2-ylphenyl)propyl]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[3-(4-propan-2-ylphenyl)propyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100756561 |
| Molecular Formula | C20H23F3N2S |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 1-[3-(4-propan-2-ylphenyl)propyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | CC(C)c1ccc(CCCNC(=S)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H23F3N2S/c1-14(2)16-10-8-15(9-11-16)5-4-12-24-19(26)25-18-7-3-6-17(13-18)20(21,22)23/h3,6-11,13-14H,4-5,12H2,1-2H3,(H2,24,25,26) |
| InChIKey | YEGGEKVKDDAEBP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|