C18H19F3N2S — CID 100611927
1-[3-(4-methylphenyl)propyl]-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 100611927) has the molecular formula C18H19F3N2S and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-[3-(4-methylphenyl)propyl]-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[3-(4-methylphenyl)propyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100611927 |
| Molecular Formula | C18H19F3N2S |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-[3-(4-methylphenyl)propyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | Cc1ccc(CCCNC(=S)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H19F3N2S/c1-13-4-6-14(7-5-13)3-2-12-22-17(24)23-16-10-8-15(9-11-16)18(19,20)21/h4-11H,2-3,12H2,1H3,(H2,22,23,24) |
| InChIKey | MKZZGAZQRQCCNM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|