C20H20F6N4OS2 — CID 132555403
1-[4-(trifluoromethyl)phenyl]-3-[2-[2-[[4-(trifluoromethyl)phenyl]carbamothioylamino]ethoxy]ethyl]thiourea (PubChem CID 132555403) has the molecular formula C20H20F6N4OS2 and a molecular weight of 510.53 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)phenyl]-3-[2-[2-[[4-(trifluoromethyl)phenyl]carbamothioylamino]ethoxy]ethyl]thiourea.
| Compound Name | 1-[4-(trifluoromethyl)phenyl]-3-[2-[2-[[4-(trifluoromethyl)phenyl]carbamothioylamino]ethoxy]ethyl]thiourea |
|---|---|
| PubChem CID | 132555403 |
| Molecular Formula | C20H20F6N4OS2 |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 1-[4-(trifluoromethyl)phenyl]-3-[2-[2-[[4-(trifluoromethyl)phenyl]carbamothioylamino]ethoxy]ethyl]thiourea |
| SMILES | FC(F)(F)c1ccc(NC(=S)NCCOCCNC(=S)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H20F6N4OS2/c21-19(22,23)13-1-5-15(6-2-13)29-17(32)27-9-11-31-12-10-28-18(33)30-16-7-3-14(4-8-16)20(24,25)26/h1-8H,9-12H2,(H2,27,29,32)(H2,28,30,33) |
| InChIKey | DOGVUGQNEOSGHP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 57.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|