C17H15Cl2F3N2S2 — CID 100599441
1-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 100599441) has the molecular formula C17H15Cl2F3N2S2 and a molecular weight of 439.36 g/mol. Its IUPAC name is 1-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100599441 |
| Molecular Formula | C17H15Cl2F3N2S2 |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | 1-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1ccc(NC(=S)NCCSCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H15Cl2F3N2S2/c18-14-6-1-11(9-15(14)19)10-26-8-7-23-16(25)24-13-4-2-12(3-5-13)17(20,21)22/h1-6,9H,7-8,10H2,(H2,23,24,25) |
| InChIKey | ZSVZQGRVMNRQBP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|