C17H17BrCl2N2S2 — CID 100599298
1-(4-bromo-3-methylphenyl)-3-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]thiourea (PubChem CID 100599298) has the molecular formula C17H17BrCl2N2S2 and a molecular weight of 464.28 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]thiourea.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]thiourea |
|---|---|
| PubChem CID | 100599298 |
| Molecular Formula | C17H17BrCl2N2S2 |
| Molecular Weight | 464.28 g/mol |
| Exact Mass | 461.94 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]thiourea |
| SMILES | Cc1cc(NC(=S)NCCSCc2ccc(Cl)c(Cl)c2)ccc1Br |
| InChI | InChI=1S/C17H17BrCl2N2S2/c1-11-8-13(3-4-14(11)18)22-17(23)21-6-7-24-10-12-2-5-15(19)16(20)9-12/h2-5,8-9H,6-7,10H2,1H3,(H2,21,22,23) |
| InChIKey | GZSBHENJGYBAQQ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.28 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|