C16H15BrCl2N2S2 — CID 100587203
1-(4-bromo-3-chlorophenyl)-3-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]thiourea (PubChem CID 100587203) has the molecular formula C16H15BrCl2N2S2 and a molecular weight of 450.25 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-3-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]thiourea.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-3-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]thiourea |
|---|---|
| PubChem CID | 100587203 |
| Molecular Formula | C16H15BrCl2N2S2 |
| Molecular Weight | 450.25 g/mol |
| Exact Mass | 447.92 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-3-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]thiourea |
| SMILES | S=C(NCCSCc1ccccc1Cl)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C16H15BrCl2N2S2/c17-13-6-5-12(9-15(13)19)21-16(22)20-7-8-23-10-11-3-1-2-4-14(11)18/h1-6,9H,7-8,10H2,(H2,20,21,22) |
| InChIKey | OXFURVHBGLBGHB-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.25 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|