C18H18ClN3S2 — CID 100587084
1-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-[4-(cyanomethyl)phenyl]thiourea (PubChem CID 100587084) has the molecular formula C18H18ClN3S2 and a molecular weight of 375.95 g/mol. Its IUPAC name is 1-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-[4-(cyanomethyl)phenyl]thiourea.
| Compound Name | 1-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-[4-(cyanomethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100587084 |
| Molecular Formula | C18H18ClN3S2 |
| Molecular Weight | 375.95 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 1-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-[4-(cyanomethyl)phenyl]thiourea |
| SMILES | N#CCc1ccc(NC(=S)NCCSCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C18H18ClN3S2/c19-17-4-2-1-3-15(17)13-24-12-11-21-18(23)22-16-7-5-14(6-8-16)9-10-20/h1-8H,9,11-13H2,(H2,21,22,23) |
| InChIKey | CSQQPXDESAXZGQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.95 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|