C23H22Cl2N2S3 — CID 100599339
1-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea (PubChem CID 100599339) has the molecular formula C23H22Cl2N2S3 and a molecular weight of 493.55 g/mol. Its IUPAC name is 1-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea.
| Compound Name | 1-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100599339 |
| Molecular Formula | C23H22Cl2N2S3 |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | 1-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
| SMILES | S=C(NCCSCc1ccc(Cl)c(Cl)c1)Nc1ccc(CSc2ccccc2)cc1 |
| InChI | InChI=1S/C23H22Cl2N2S3/c24-21-11-8-18(14-22(21)25)15-29-13-12-26-23(28)27-19-9-6-17(7-10-19)16-30-20-4-2-1-3-5-20/h1-11,14H,12-13,15-16H2,(H2,26,27,28) |
| InChIKey | OVVFCZPJPNIOKP-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|