C24H23Cl2NOS2 — CID 126414923
N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-[(4-methylphenyl)sulfanylmethyl]benzamide (PubChem CID 126414923) has the molecular formula C24H23Cl2NOS2 and a molecular weight of 476.49 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-[(4-methylphenyl)sulfanylmethyl]benzamide.
| Compound Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-[(4-methylphenyl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 126414923 |
| Molecular Formula | C24H23Cl2NOS2 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-[(4-methylphenyl)sulfanylmethyl]benzamide |
| SMILES | Cc1ccc(SCc2ccc(C(=O)NCCSCc3ccc(Cl)c(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C24H23Cl2NOS2/c1-17-2-9-21(10-3-17)30-16-18-4-7-20(8-5-18)24(28)27-12-13-29-15-19-6-11-22(25)23(26)14-19/h2-11,14H,12-13,15-16H2,1H3,(H,27,28) |
| InChIKey | OHZJBOSLNQKQPZ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|