C16H14Cl2INOS — CID 100513186
N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-iodobenzamide (PubChem CID 100513186) has the molecular formula C16H14Cl2INOS and a molecular weight of 466.17 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-iodobenzamide.
| Compound Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 100513186 |
| Molecular Formula | C16H14Cl2INOS |
| Molecular Weight | 466.17 g/mol |
| Exact Mass | 464.92 |
| IUPAC Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-iodobenzamide |
| SMILES | O=C(NCCSCc1ccc(Cl)c(Cl)c1)c1cccc(I)c1 |
| InChI | InChI=1S/C16H14Cl2INOS/c17-14-5-4-11(8-15(14)18)10-22-7-6-20-16(21)12-2-1-3-13(19)9-12/h1-5,8-9H,6-7,10H2,(H,20,21) |
| InChIKey | HJNONMOQOOKKIB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.17 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|