C20H19Cl2N3OS — CID 43922691
N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-(imidazol-1-ylmethyl)benzamide (PubChem CID 43922691) has the molecular formula C20H19Cl2N3OS and a molecular weight of 420.37 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-(imidazol-1-ylmethyl)benzamide.
| Compound Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-(imidazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 43922691 |
| Molecular Formula | C20H19Cl2N3OS |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-(imidazol-1-ylmethyl)benzamide |
| SMILES | O=C(NCCSCc1ccc(Cl)c(Cl)c1)c1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C20H19Cl2N3OS/c21-18-6-3-16(11-19(18)22)13-27-10-8-24-20(26)17-4-1-15(2-5-17)12-25-9-7-23-14-25/h1-7,9,11,14H,8,10,12-13H2,(H,24,26) |
| InChIKey | ZBQLJBJXGAOFOZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|