C23H28Cl2N2OS — CID 30379302
N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-[[(3R)-3-methylpiperidin-1-yl]methyl]benzamide (PubChem CID 30379302) has the molecular formula C23H28Cl2N2OS and a molecular weight of 451.46 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-[[(3R)-3-methylpiperidin-1-yl]methyl]benzamide.
| Compound Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-[[(3R)-3-methylpiperidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 30379302 |
| Molecular Formula | C23H28Cl2N2OS |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-[[(3R)-3-methylpiperidin-1-yl]methyl]benzamide |
| SMILES | C[C@@H]1CCCN(Cc2ccc(C(=O)NCCSCc3ccc(Cl)c(Cl)c3)cc2)C1 |
| InChI | InChI=1S/C23H28Cl2N2OS/c1-17-3-2-11-27(14-17)15-18-4-7-20(8-5-18)23(28)26-10-12-29-16-19-6-9-21(24)22(25)13-19/h4-9,13,17H,2-3,10-12,14-16H2,1H3,(H,26,28)/t17-/m1/s1 |
| InChIKey | OGYUDQCRGAMJGB-QGZVFWFLSA-N |
| XLogP | 5.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|