C22H26Cl2N2O3S2 — CID 99954898
N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-(piperidin-1-ylsulfonylmethyl)benzamide (PubChem CID 99954898) has the molecular formula C22H26Cl2N2O3S2 and a molecular weight of 501.50 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-(piperidin-1-ylsulfonylmethyl)benzamide.
| Compound Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-(piperidin-1-ylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 99954898 |
| Molecular Formula | C22H26Cl2N2O3S2 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-(piperidin-1-ylsulfonylmethyl)benzamide |
| SMILES | O=C(NCCSCc1ccc(Cl)c(Cl)c1)c1ccc(CS(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H26Cl2N2O3S2/c23-20-9-6-18(14-21(20)24)15-30-13-10-25-22(27)19-7-4-17(5-8-19)16-31(28,29)26-11-2-1-3-12-26/h4-9,14H,1-3,10-13,15-16H2,(H,25,27) |
| InChIKey | NJCPKVNOCQGQRJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|