C16H22Cl2N2O3S2 — CID 132667749
N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-1-methylsulfonylpiperidine-3-carboxamide (PubChem CID 132667749) has the molecular formula C16H22Cl2N2O3S2 and a molecular weight of 425.40 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-1-methylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-1-methylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 132667749 |
| Molecular Formula | C16H22Cl2N2O3S2 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-1-methylsulfonylpiperidine-3-carboxamide |
| SMILES | CS(=O)(=O)N1CCCC(C(=O)NCCSCc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H22Cl2N2O3S2/c1-25(22,23)20-7-2-3-13(10-20)16(21)19-6-8-24-11-12-4-5-14(17)15(18)9-12/h4-5,9,13H,2-3,6-8,10-11H2,1H3,(H,19,21) |
| InChIKey | IKNBVPYLEBPHKW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|