C17H25Cl2N3O3S2 — CID 132613319
N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-1-(dimethylsulfamoyl)piperidine-3-carboxamide (PubChem CID 132613319) has the molecular formula C17H25Cl2N3O3S2 and a molecular weight of 454.45 g/mol. Its IUPAC name is N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-1-(dimethylsulfamoyl)piperidine-3-carboxamide.
| Compound Name | N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-1-(dimethylsulfamoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 132613319 |
| Molecular Formula | C17H25Cl2N3O3S2 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-1-(dimethylsulfamoyl)piperidine-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)N1CCCC(C(=O)NCCSCc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C17H25Cl2N3O3S2/c1-21(2)27(24,25)22-8-3-4-13(11-22)17(23)20-7-9-26-12-14-5-6-15(18)10-16(14)19/h5-6,10,13H,3-4,7-9,11-12H2,1-2H3,(H,20,23) |
| InChIKey | WWQCBNTYRPXCEC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|