C18H29N3O3S2 — CID 28569761
(3R)-1-(dimethylsulfamoyl)-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]piperidine-3-carboxamide (PubChem CID 28569761) has the molecular formula C18H29N3O3S2 and a molecular weight of 399.58 g/mol. Its IUPAC name is (3R)-1-(dimethylsulfamoyl)-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-(dimethylsulfamoyl)-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 28569761 |
| Molecular Formula | C18H29N3O3S2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | (3R)-1-(dimethylsulfamoyl)-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]piperidine-3-carboxamide |
| SMILES | Cc1cccc(CSCCNC(=O)[C@@H]2CCCN(S(=O)(=O)N(C)C)C2)c1 |
| InChI | InChI=1S/C18H29N3O3S2/c1-15-6-4-7-16(12-15)14-25-11-9-19-18(22)17-8-5-10-21(13-17)26(23,24)20(2)3/h4,6-7,12,17H,5,8-11,13-14H2,1-3H3,(H,19,22)/t17-/m1/s1 |
| InChIKey | RXQAJHDBCLSZRU-QGZVFWFLSA-N |
| XLogP | 1.86 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|