C18H27N3O2S — CID 97145050
(3R)-3-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]piperidine-1,3-dicarboxamide (PubChem CID 97145050) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is (3R)-3-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 97145050 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (3R)-3-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]piperidine-1,3-dicarboxamide |
| SMILES | Cc1cccc(CSCCCNC(=O)[C@@H]2CCCN(C(N)=O)C2)c1 |
| InChI | InChI=1S/C18H27N3O2S/c1-14-5-2-6-15(11-14)13-24-10-4-8-20-17(22)16-7-3-9-21(12-16)18(19)23/h2,5-6,11,16H,3-4,7-10,12-13H2,1H3,(H2,19,23)(H,20,22)/t16-/m1/s1 |
| InChIKey | JDDITDZKASWENP-MRXNPFEDSA-N |
| XLogP | 2.53 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|