C15H23N3O3S — CID 97454873
(3R)-3-N-[3-(furan-2-ylmethylsulfanyl)propyl]piperidine-1,3-dicarboxamide (PubChem CID 97454873) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is (3R)-3-N-[3-(furan-2-ylmethylsulfanyl)propyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-[3-(furan-2-ylmethylsulfanyl)propyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 97454873 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (3R)-3-N-[3-(furan-2-ylmethylsulfanyl)propyl]piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)N1CCC[C@@H](C(=O)NCCCSCc2ccco2)C1 |
| InChI | InChI=1S/C15H23N3O3S/c16-15(20)18-7-1-4-12(10-18)14(19)17-6-3-9-22-11-13-5-2-8-21-13/h2,5,8,12H,1,3-4,6-7,9-11H2,(H2,16,20)(H,17,19)/t12-/m1/s1 |
| InChIKey | CIMMWZCXUZGOPG-GFCCVEGCSA-N |
| XLogP | 1.81 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|