C19H29N3O4S — CID 133109656
(3S,5R)-N-[3-(furan-2-ylmethylsulfanyl)propyl]-5-(morpholine-4-carbonyl)piperidine-3-carboxamide (PubChem CID 133109656) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is (3S,5R)-N-[3-(furan-2-ylmethylsulfanyl)propyl]-5-(morpholine-4-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3S,5R)-N-[3-(furan-2-ylmethylsulfanyl)propyl]-5-(morpholine-4-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133109656 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (3S,5R)-N-[3-(furan-2-ylmethylsulfanyl)propyl]-5-(morpholine-4-carbonyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCCSCc1ccco1)[C@@H]1CNC[C@H](C(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C19H29N3O4S/c23-18(21-4-2-10-27-14-17-3-1-7-26-17)15-11-16(13-20-12-15)19(24)22-5-8-25-9-6-22/h1,3,7,15-16,20H,2,4-6,8-14H2,(H,21,23)/t15-,16+/m0/s1 |
| InChIKey | SQRZWVFRVSODPB-JKSUJKDBSA-N |
| XLogP | 1.10 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|