C17H22N4O3S — CID 74236548
N-[3-(furan-2-ylmethylsulfanyl)propyl]-2-morpholin-4-ylpyrimidine-5-carboxamide (PubChem CID 74236548) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is N-[3-(furan-2-ylmethylsulfanyl)propyl]-2-morpholin-4-ylpyrimidine-5-carboxamide.
| Compound Name | N-[3-(furan-2-ylmethylsulfanyl)propyl]-2-morpholin-4-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 74236548 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[3-(furan-2-ylmethylsulfanyl)propyl]-2-morpholin-4-ylpyrimidine-5-carboxamide |
| SMILES | O=C(NCCCSCc1ccco1)c1cnc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C17H22N4O3S/c22-16(18-4-2-10-25-13-15-3-1-7-24-15)14-11-19-17(20-12-14)21-5-8-23-9-6-21/h1,3,7,11-12H,2,4-6,8-10,13H2,(H,18,22) |
| InChIKey | ZNZDEEASYLXIHL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|