C16H24N6O3 — CID 109253039
2-(4-formylpiperazin-1-yl)-N-(2-morpholin-4-ylethyl)pyrimidine-5-carboxamide (PubChem CID 109253039) has the molecular formula C16H24N6O3 and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-(4-formylpiperazin-1-yl)-N-(2-morpholin-4-ylethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(4-formylpiperazin-1-yl)-N-(2-morpholin-4-ylethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109253039 |
| Molecular Formula | C16H24N6O3 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-(4-formylpiperazin-1-yl)-N-(2-morpholin-4-ylethyl)pyrimidine-5-carboxamide |
| SMILES | O=CN1CCN(c2ncc(C(=O)NCCN3CCOCC3)cn2)CC1 |
| InChI | InChI=1S/C16H24N6O3/c23-13-21-3-5-22(6-4-21)16-18-11-14(12-19-16)15(24)17-1-2-20-7-9-25-10-8-20/h11-13H,1-10H2,(H,17,24) |
| InChIKey | BEZJYEMUGMKSLK-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|