C13H24N4O3 — CID 108994880
2-(4-formylpiperazin-1-yl)-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 108994880) has the molecular formula C13H24N4O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-(4-formylpiperazin-1-yl)-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-(4-formylpiperazin-1-yl)-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 108994880 |
| Molecular Formula | C13H24N4O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 2-(4-formylpiperazin-1-yl)-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | O=CN1CCN(CC(=O)NCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C13H24N4O3/c18-12-17-5-3-16(4-6-17)11-13(19)14-1-2-15-7-9-20-10-8-15/h12H,1-11H2,(H,14,19) |
| InChIKey | OSXLDLYAFNGVSK-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|