C19H32N4O4 — CID 109147174
4-(4-formylpiperazine-1-carbonyl)-N-(2-morpholin-4-ylethyl)cyclohexane-1-carboxamide (PubChem CID 109147174) has the molecular formula C19H32N4O4 and a molecular weight of 380.49 g/mol. Its IUPAC name is 4-(4-formylpiperazine-1-carbonyl)-N-(2-morpholin-4-ylethyl)cyclohexane-1-carboxamide.
| Compound Name | 4-(4-formylpiperazine-1-carbonyl)-N-(2-morpholin-4-ylethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 109147174 |
| Molecular Formula | C19H32N4O4 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 4-(4-formylpiperazine-1-carbonyl)-N-(2-morpholin-4-ylethyl)cyclohexane-1-carboxamide |
| SMILES | O=CN1CCN(C(=O)C2CCC(C(=O)NCCN3CCOCC3)CC2)CC1 |
| InChI | InChI=1S/C19H32N4O4/c24-15-22-7-9-23(10-8-22)19(26)17-3-1-16(2-4-17)18(25)20-5-6-21-11-13-27-14-12-21/h15-17H,1-14H2,(H,20,25) |
| InChIKey | CVUCJYSRJLVJPS-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|