C17H23N3O3S — CID 70734413
2-tert-butyl-N-[3-(furan-2-ylmethylsulfanyl)propyl]-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 70734413) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 2-tert-butyl-N-[3-(furan-2-ylmethylsulfanyl)propyl]-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-tert-butyl-N-[3-(furan-2-ylmethylsulfanyl)propyl]-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 70734413 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-tert-butyl-N-[3-(furan-2-ylmethylsulfanyl)propyl]-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | CC(C)(C)c1ncc(C(=O)NCCCSCc2ccco2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H23N3O3S/c1-17(2,3)16-19-10-13(15(22)20-16)14(21)18-7-5-9-24-11-12-6-4-8-23-12/h4,6,8,10H,5,7,9,11H2,1-3H3,(H,18,21)(H,19,20,22) |
| InChIKey | KLDYDUMBBUJYIJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|