C14H19N3O2S2 — CID 122562891
3-[3-(furan-2-ylmethylsulfanyl)propyl]-1-methyl-1-(1,3-thiazol-2-ylmethyl)urea (PubChem CID 122562891) has the molecular formula C14H19N3O2S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is 3-[3-(furan-2-ylmethylsulfanyl)propyl]-1-methyl-1-(1,3-thiazol-2-ylmethyl)urea.
| Compound Name | 3-[3-(furan-2-ylmethylsulfanyl)propyl]-1-methyl-1-(1,3-thiazol-2-ylmethyl)urea |
|---|---|
| PubChem CID | 122562891 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 3-[3-(furan-2-ylmethylsulfanyl)propyl]-1-methyl-1-(1,3-thiazol-2-ylmethyl)urea |
| SMILES | CN(Cc1nccs1)C(=O)NCCCSCc1ccco1 |
| InChI | InChI=1S/C14H19N3O2S2/c1-17(10-13-15-6-9-21-13)14(18)16-5-3-8-20-11-12-4-2-7-19-12/h2,4,6-7,9H,3,5,8,10-11H2,1H3,(H,16,18) |
| InChIKey | IAMHRVSJQCORRF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|