C16H19ClN2O2S — CID 23607944
1-(3-chloro-2-methylphenyl)-3-[3-(furan-2-ylmethylsulfanyl)propyl]urea (PubChem CID 23607944) has the molecular formula C16H19ClN2O2S and a molecular weight of 338.86 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[3-(furan-2-ylmethylsulfanyl)propyl]urea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[3-(furan-2-ylmethylsulfanyl)propyl]urea |
|---|---|
| PubChem CID | 23607944 |
| Molecular Formula | C16H19ClN2O2S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[3-(furan-2-ylmethylsulfanyl)propyl]urea |
| SMILES | Cc1c(Cl)cccc1NC(=O)NCCCSCc1ccco1 |
| InChI | InChI=1S/C16H19ClN2O2S/c1-12-14(17)6-2-7-15(12)19-16(20)18-8-4-10-22-11-13-5-3-9-21-13/h2-3,5-7,9H,4,8,10-11H2,1H3,(H2,18,19,20) |
| InChIKey | YVRMLZLHKHLADG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|