C13H13ClN2OS — CID 2826690
1-(3-chloro-2-methylphenyl)-3-(furan-2-ylmethyl)thiourea (PubChem CID 2826690) has the molecular formula C13H13ClN2OS and a molecular weight of 280.78 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2826690 |
| Molecular Formula | C13H13ClN2OS |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-(furan-2-ylmethyl)thiourea |
| SMILES | Cc1c(Cl)cccc1NC(=S)NCc1ccco1 |
| InChI | InChI=1S/C13H13ClN2OS/c1-9-11(14)5-2-6-12(9)16-13(18)15-8-10-4-3-7-17-10/h2-7H,8H2,1H3,(H2,15,16,18) |
| InChIKey | SWUHKONRCGAIOS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|