C17H17ClN2O3 — CID 108974651
1-N'-(3-chloro-2-methylphenyl)-1-N-(furan-2-ylmethyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108974651) has the molecular formula C17H17ClN2O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is 1-N'-(3-chloro-2-methylphenyl)-1-N-(furan-2-ylmethyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(3-chloro-2-methylphenyl)-1-N-(furan-2-ylmethyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108974651 |
| Molecular Formula | C17H17ClN2O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 1-N'-(3-chloro-2-methylphenyl)-1-N-(furan-2-ylmethyl)cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C1(C(=O)NCc2ccco2)CC1 |
| InChI | InChI=1S/C17H17ClN2O3/c1-11-13(18)5-2-6-14(11)20-16(22)17(7-8-17)15(21)19-10-12-4-3-9-23-12/h2-6,9H,7-8,10H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | OBNXJSQLNPVVIQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|