C12H18ClN3S — CID 8668575
1-(3-chloro-2-methylphenyl)-3-[2-(dimethylamino)ethyl]thiourea (PubChem CID 8668575) has the molecular formula C12H18ClN3S and a molecular weight of 271.82 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[2-(dimethylamino)ethyl]thiourea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[2-(dimethylamino)ethyl]thiourea |
|---|---|
| PubChem CID | 8668575 |
| Molecular Formula | C12H18ClN3S |
| Molecular Weight | 271.82 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[2-(dimethylamino)ethyl]thiourea |
| SMILES | Cc1c(Cl)cccc1NC(=S)NCCN(C)C |
| InChI | InChI=1S/C12H18ClN3S/c1-9-10(13)5-4-6-11(9)15-12(17)14-7-8-16(2)3/h4-6H,7-8H2,1-3H3,(H2,14,15,17) |
| InChIKey | XNXLHSBBWKCDGL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.82 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|