C16H19ClN4S — CID 43076066
1-(3-chloro-2-methylphenyl)-3-[[2-(dimethylamino)-3-pyridinyl]methyl]thiourea (PubChem CID 43076066) has the molecular formula C16H19ClN4S and a molecular weight of 334.88 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[[2-(dimethylamino)-3-pyridinyl]methyl]thiourea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[[2-(dimethylamino)-3-pyridinyl]methyl]thiourea |
|---|---|
| PubChem CID | 43076066 |
| Molecular Formula | C16H19ClN4S |
| Molecular Weight | 334.88 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[[2-(dimethylamino)-3-pyridinyl]methyl]thiourea |
| SMILES | Cc1c(Cl)cccc1NC(=S)NCc1cccnc1N(C)C |
| InChI | InChI=1S/C16H19ClN4S/c1-11-13(17)7-4-8-14(11)20-16(22)19-10-12-6-5-9-18-15(12)21(2)3/h4-9H,10H2,1-3H3,(H2,19,20,22) |
| InChIKey | ASCRFUCYRZBHNS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.88 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|