C17H22N4S2 — CID 43076043
1-[[2-(dimethylamino)-3-pyridinyl]methyl]-3-(2-phenylsulfanylethyl)thiourea (PubChem CID 43076043) has the molecular formula C17H22N4S2 and a molecular weight of 346.53 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-3-pyridinyl]methyl]-3-(2-phenylsulfanylethyl)thiourea.
| Compound Name | 1-[[2-(dimethylamino)-3-pyridinyl]methyl]-3-(2-phenylsulfanylethyl)thiourea |
|---|---|
| PubChem CID | 43076043 |
| Molecular Formula | C17H22N4S2 |
| Molecular Weight | 346.53 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 1-[[2-(dimethylamino)-3-pyridinyl]methyl]-3-(2-phenylsulfanylethyl)thiourea |
| SMILES | CN(C)c1ncccc1CNC(=S)NCCSc1ccccc1 |
| InChI | InChI=1S/C17H22N4S2/c1-21(2)16-14(7-6-10-18-16)13-20-17(22)19-11-12-23-15-8-4-3-5-9-15/h3-10H,11-13H2,1-2H3,(H2,19,20,22) |
| InChIKey | RHKGQBSXDPZXGR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|